CAS 1396777-19-7 is the registry number for 4-Bromo-n-ethyl-2,n-dimethyl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-N-ethyl-N,2-dimethylbenzenesulfonamide (CAS 1396777-19-7) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 4-bromo-N-ethyl-N,2-dimethylbenzenesulfonamide. InChIKey: NHKHYALYYDPUFH-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 4-bromo-N-ethyl-N,2-dimethylbenzenesulfonamide |
| InChIKey | NHKHYALYYDPUFH-UHFFFAOYSA-N |
| SMILES | CCN(C)S(=O)(=O)C1=C(C=C(C=C1)Br)C |
Computed by PubChem (NCBI)