cas: 207681-67-2 — see every product listed under this CAS number, including other names
3-Bromo-N-methoxy-N-methylbenzamide 98% (CAS 207681-67-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A252486-250mg |
| cas | 207681-67-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 531.69 Pln | |
| Ambeed | 10g | 815.38 Pln | |
| Ambeed | 25g | 1555.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A252486 |
3-bromo-N-methoxy-N-methylbenzamide (CAS 207681-67-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 3-bromo-N-methoxy-N-methylbenzamide. InChIKey: VPWARUVASBJSPY-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 3-bromo-N-methoxy-N-methylbenzamide |
| InChIKey | VPWARUVASBJSPY-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=CC=C1)Br)OC |
Computed by PubChem (NCBI)