cas: 19419-09-1 — see every product listed under this CAS number, including other names
3-Bromocinnolin-4-ol 95+% (CAS 19419-09-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102535-100mg |
| cas | 19419-09-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1989.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A102535 |
3-bromo-1H-cinnolin-4-one (CAS 19419-09-1) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 3-bromo-1H-cinnolin-4-one. InChIKey: TZRVSTXNTMEAGB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 3-bromo-1H-cinnolin-4-one |
| InChIKey | TZRVSTXNTMEAGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=NN2)Br |
Computed by PubChem (NCBI)