cas: 939-16-2 — see every product listed under this CAS number, including other names
3-Bromoquinolin-2(1H)-one, 96% (CAS 939-16-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225134-100MG |
| cas | 939-16-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2137.81 Pln | |
| Fluorochem | 10g | 3059.36 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-1H-quinolin-2-one (CAS 939-16-2) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 3-bromo-1H-quinolin-2-one. InChIKey: AGARPHPERRYPRP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 3-bromo-1H-quinolin-2-one |
| InChIKey | AGARPHPERRYPRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)N2)Br |
Computed by PubChem (NCBI)