CAS 864738-31-8 appears in our catalog under these names: 8-Bromoisoquinolin-4-ol, 95%, 8-BROMOISOQUINOLIN-4-OL, 98%, 8-Bromoisoquinolin-4-ol, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g.
8-bromoisoquinolin-4-ol (CAS 864738-31-8) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 8-bromoisoquinolin-4-ol. InChIKey: IURMCZMKZBTSLW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 8-bromoisoquinolin-4-ol |
| InChIKey | IURMCZMKZBTSLW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2C(=C1)Br)O |
Computed by PubChem (NCBI)