CAS 93273-63-3 appears in our catalog under these names: 4-Acetyl-2-bromobenzonitrile, 95%, 4-Acetyl-2-bromobenzonitrile, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-acetyl-2-bromobenzonitrile (CAS 93273-63-3) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-acetyl-2-bromobenzonitrile. InChIKey: RDSQFNDEGYBDJD-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-acetyl-2-bromobenzonitrile |
| InChIKey | RDSQFNDEGYBDJD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C#N)Br |
Computed by PubChem (NCBI)