CAS 1784957-23-8 appears in our catalog under these names: 4-Bromoisoquinolin-8-ol, 95%, 4-Bromoisoquinolin-8-ol 98%, 4-BROMOISOQUINOLIN-8-OL, 98%, 4-Bromoisoquinolin-8-ol, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
4-bromoisoquinolin-8-ol (CAS 1784957-23-8) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-bromoisoquinolin-8-ol. InChIKey: GXOYPNNECSMYNC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-bromoisoquinolin-8-ol |
| InChIKey | GXOYPNNECSMYNC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2C(=C1)O)Br |
Computed by PubChem (NCBI)