cas: 39105-39-0 — see every product listed under this CAS number, including other names
3-Chloro-1-(2,3-dihydro-1H-inden-5-yl)propan-1-one (CAS 39105-39-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791364-250MG |
| cas | 39105-39-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 4610.89 Pln | |
| Fluorochem | 1g | 10509.86 Pln | |
| Fluorochem | 5g | 31533.71 Pln |
| delivery time | 3-4 weeks |
|---|
3-chloro-1-(2,3-dihydro-1H-inden-5-yl)propan-1-one (CAS 39105-39-0) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 208.68 g/mol. IUPAC name: 3-chloro-1-(2,3-dihydro-1H-inden-5-yl)propan-1-one. InChIKey: VTEOHCVWRXWJEI-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 3-chloro-1-(2,3-dihydro-1H-inden-5-yl)propan-1-one |
| InChIKey | VTEOHCVWRXWJEI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C(=O)CCCl |
Computed by PubChem (NCBI)