CAS 1187385-73-4 is the registry number for 4-(5-Chloro-2-methylphenyl)-2-methylbut-3-yn-2-ol, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
4-(5-chloro-2-methylphenyl)-2-methylbut-3-yn-2-ol (CAS 1187385-73-4) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 208.68 g/mol. IUPAC name: 4-(5-chloro-2-methylphenyl)-2-methylbut-3-yn-2-ol. InChIKey: KLSFKKMBWWUESP-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 4-(5-chloro-2-methylphenyl)-2-methylbut-3-yn-2-ol |
| InChIKey | KLSFKKMBWWUESP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)C#CC(C)(C)O |
Computed by PubChem (NCBI)