CAS 17380-62-0 appears in our catalog under these names: 1-Phenylcyclopentane-1-carbonyl chloride, 95%, 1-Phenylcyclopentanecarbonyl chloride, 1-phenylcyclopentane-1-carbonyl chloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 0,5g, 25g.
1-phenylcyclopentane-1-carbonyl chloride (CAS 17380-62-0) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 208.68 g/mol. IUPAC name: 1-phenylcyclopentane-1-carbonyl chloride. InChIKey: NOYKUYNVZHTPCI-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 1-phenylcyclopentane-1-carbonyl chloride |
| InChIKey | NOYKUYNVZHTPCI-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)