Products 149455-83-4
CAS 149455-83-4 is the registry number for 6-Chloro-2,2-dimethyl-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one (CAS 149455-83-4) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 208.68 g/mol. IUPAC name: 6-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one. InChIKey: ZOEDDXYDPWNSMU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 6-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one |
| InChIKey | ZOEDDXYDPWNSMU-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1=O)C=CC(=C2)Cl)C |
Computed by PubChem (NCBI)