cas: 886761-67-7 — see every product listed under this CAS number, including other names
3-Chloro-2,4-difluorophenylacetonitrile, 97%, 97% (CAS 886761-67-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GY5I-1g |
| cas | 886761-67-7 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 467.60 Pln | |
| Chemat | 10g | 827.60 Pln | |
| Chemat | 25g | 1902.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3-chloro-2,4-difluorophenyl)acetonitrile (CAS 886761-67-7) is a chemical compound with the molecular formula C8H4ClF2N and a molecular weight of 187.57 g/mol. IUPAC name: 2-(3-chloro-2,4-difluorophenyl)acetonitrile. InChIKey: LTQOCFQXFUZWLB-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2N |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 2-(3-chloro-2,4-difluorophenyl)acetonitrile |
| InChIKey | LTQOCFQXFUZWLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC#N)F)Cl)F |
Computed by PubChem (NCBI)