CAS 1000540-50-0 appears in our catalog under these names: 4-Chloro-3,5-difluorophenylacetonitrile, 95%, 4-Chloro-3,5-difluorophenylacetonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
2-(4-chloro-3,5-difluorophenyl)acetonitrile (CAS 1000540-50-0) is a chemical compound with the molecular formula C8H4ClF2N and a molecular weight of 187.57 g/mol. IUPAC name: 2-(4-chloro-3,5-difluorophenyl)acetonitrile. InChIKey: NAPOZFDLZLEPNG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2N |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 2-(4-chloro-3,5-difluorophenyl)acetonitrile |
| InChIKey | NAPOZFDLZLEPNG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)CC#N |
Computed by PubChem (NCBI)