cas: 886761-67-7 — see every product listed under this CAS number, including other names
3-Chloro-2,4-difluorophenylacetonitrile, 97% (CAS 886761-67-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F342640-1G |
| cas | 886761-67-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 747.67 Pln | |
| Fluorochem | 10g | 1346.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-chloro-2,4-difluorophenyl)acetonitrile (CAS 886761-67-7) is a chemical compound with the molecular formula C8H4ClF2N and a molecular weight of 187.57 g/mol. IUPAC name: 2-(3-chloro-2,4-difluorophenyl)acetonitrile. InChIKey: LTQOCFQXFUZWLB-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2N |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 2-(3-chloro-2,4-difluorophenyl)acetonitrile |
| InChIKey | LTQOCFQXFUZWLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC#N)F)Cl)F |
Computed by PubChem (NCBI)