CAS 1250050-25-9 appears in our catalog under these names: 2-Chloro-2-(2,4-difluorophenyl)acetonitrile, 95%, 2-Chloro-2-(2,4-difluorophenyl)acetonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
2-chloro-2-(2,4-difluorophenyl)acetonitrile (CAS 1250050-25-9) is a chemical compound with the molecular formula C8H4ClF2N and a molecular weight of 187.57 g/mol. IUPAC name: 2-chloro-2-(2,4-difluorophenyl)acetonitrile. InChIKey: WJVFUIFMIMGJHH-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2N |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 2-chloro-2-(2,4-difluorophenyl)acetonitrile |
| InChIKey | WJVFUIFMIMGJHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(C#N)Cl |
Computed by PubChem (NCBI)