cas: 524955-09-7 — see every product listed under this CAS number, including other names
3-Chloro-4-(pyridin-2-ylmethoxy)aniline 95% (CAS 524955-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119481-250mg |
| cas | 524955-09-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 737.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A119481 |
3-chloro-4-(pyridin-2-ylmethoxy)aniline (CAS 524955-09-7) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 3-chloro-4-(pyridin-2-ylmethoxy)aniline. InChIKey: XCAPJQSICQSUJP-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 3-chloro-4-(pyridin-2-ylmethoxy)aniline |
| InChIKey | XCAPJQSICQSUJP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)COC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)