cas: 1691650-41-5 — see every product listed under this CAS number, including other names
3-Chloro-4-cyclopropylbenzaldehyde (CAS 1691650-41-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630916-250MG |
| cas | 1691650-41-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 6662.26 Pln | |
| Fluorochem | 500mg | 7557.77 Pln |
| delivery time | 3-4 weeks |
|---|
3-chloro-4-cyclopropylbenzaldehyde (CAS 1691650-41-5) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 3-chloro-4-cyclopropylbenzaldehyde. InChIKey: YFMKHMJQHSOYKJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 3-chloro-4-cyclopropylbenzaldehyde |
| InChIKey | YFMKHMJQHSOYKJ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)