CAS 17556-18-2 appears in our catalog under these names: 6-Chloro-2-tetralone, 98%, 6-Chloro-3,4-dihydronaphthalen-2(1H)-one 98%, 6-Chloro-3,4-dihydronaphthalen-2(1H)-one, 95%, 2(1H)-Naphthalenone, 6-chloro-3,4-dihydro-, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100g, 100mg.
6-chloro-3,4-dihydro-1H-naphthalen-2-one (CAS 17556-18-2) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-1H-naphthalen-2-one. InChIKey: QQSYTUUAEZUAKL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | QQSYTUUAEZUAKL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)