Products 919078-00-5
CAS 919078-00-5 appears in our catalog under these names: 6-Chloro-5-methyl-2,3-dihydro-1h-inden-1-one, 95%, 6-Chloro-5-methyl-2,3-dihydro-1H-inden-1-one 98%, 6-Chloro-5-methyl-2，3-dihydro-1H-inden-1-one, 98%, 98%, 6-Chloro-5-methyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-chloro-5-methyl-2,3-dihydroinden-1-one (CAS 919078-00-5) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-5-methyl-2,3-dihydroinden-1-one. InChIKey: GZWOKGOZBZOPDC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-5-methyl-2,3-dihydroinden-1-one |
| InChIKey | GZWOKGOZBZOPDC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)C(=O)CC2 |
Computed by PubChem (NCBI)