CAS 1691650-41-5 is the registry number for 3-Chloro-4-cyclopropylbenzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
3-chloro-4-cyclopropylbenzaldehyde (CAS 1691650-41-5) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 3-chloro-4-cyclopropylbenzaldehyde. InChIKey: YFMKHMJQHSOYKJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 3-chloro-4-cyclopropylbenzaldehyde |
| InChIKey | YFMKHMJQHSOYKJ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)