cas: 208511-07-3 — see every product listed under this CAS number, including other names
3-Chloro-4-nitro-1H-indole, 97%, 97% (CAS 208511-07-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JQ0-500mg |
| cas | 208511-07-3 |
| size | 500mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 165.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 530.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-nitro-1H-indole (CAS 208511-07-3) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 3-chloro-4-nitro-1H-indole. InChIKey: IBHFPQVONMGFLC-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 3-chloro-4-nitro-1H-indole |
| InChIKey | IBHFPQVONMGFLC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=CN2)Cl |
Computed by PubChem (NCBI)