Products 875305-85-4
CAS 875305-85-4 appears in our catalog under these names: 5-Chloro-2h-indazole-7-carboxylic acid, 95%, 5-Chloro-1h-indazole-7-carboxylic acid, 95%, 5-Chloro-1H-indazole-7-carboxylic acid, 97%, 5-chloro-1h-indazole-7-carboxylic acid, 5-CHLORO-1H-INDAZOLE-7-CARBOXYLIC ACID, 96%, 96%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 500mg.
5-chloro-1H-indazole-7-carboxylic acid (CAS 875305-85-4) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 5-chloro-1H-indazole-7-carboxylic acid. InChIKey: VNJXVZJEPIMSIW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 5-chloro-1H-indazole-7-carboxylic acid |
| InChIKey | VNJXVZJEPIMSIW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)C(=O)O)Cl |
Computed by PubChem (NCBI)