cas: 57507-34-3 — see every product listed under this CAS number, including other names
3-Chloro-4-nitrobenzaldehyde 98% (CAS 57507-34-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A773892-250mg |
| cas | 57507-34-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 2606.50 Pln | |
| Ambeed | 25g | 8942.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A773892 |
3-chloro-4-nitrobenzaldehyde (CAS 57507-34-3) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 3-chloro-4-nitrobenzaldehyde. InChIKey: LINXIPJBQRYFHA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 3-chloro-4-nitrobenzaldehyde |
| InChIKey | LINXIPJBQRYFHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)