CAS 151276-13-0 appears in our catalog under these names: 3–Chloro–5–(trifluoromethoxy)aniline, 3-Chloro-5-(trifluoromethoxy)aniline, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
3-chloro-5-(trifluoromethoxy)aniline (CAS 151276-13-0) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)aniline. InChIKey: LGCOAKFQLUXQAB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)aniline |
| InChIKey | LGCOAKFQLUXQAB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)