cas: 1017778-52-7 — see every product listed under this CAS number, including other names
3-Chloro-5-(trifluoromethoxy)phenol 95% (CAS 1017778-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A532792-250mg |
| cas | 1017778-52-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 453.81 Pln | |
| Ambeed | 5g | 1977.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A532792 |
3-chloro-5-(trifluoromethoxy)phenol (CAS 1017778-52-7) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)phenol. InChIKey: GDQVMGRMDBOXLX-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)phenol |
| InChIKey | GDQVMGRMDBOXLX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)O |
Computed by PubChem (NCBI)