cas: 22353-33-9 — see every product listed under this CAS number, including other names
3-Chloro-5-nitropyridine, 98% (CAS 22353-33-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A113428-10g |
| cas | 22353-33-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4509.82 Pln | |
| AmBeed | 25g | 8956.15 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1257.91 Pln | |
| Fluorochem | 5g | 3319.68 Pln | |
| Fluorochem | 10g | 5214.85 Pln | |
| Fluorochem | 25g | 9770.54 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-5-nitropyridine (CAS 22353-33-9) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 3-chloro-5-nitropyridine. InChIKey: MUTXEQVAHJCPSL-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 3-chloro-5-nitropyridine |
| InChIKey | MUTXEQVAHJCPSL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)