CAS 5470-18-8 appears in our catalog under these names: 2-Chloro-3-nitropyridine, 2–Chloro–3–nitropyridine, 2-Chloro-3-nitropyridine, 99% , 2-Chloro-3-nitropyridine, >99.0%(GC), 2-Chloro-3-nitropyridine, 99+%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 0,5kg, 0,25kg, 1kg.
2-chloro-3-nitropyridine (CAS 5470-18-8) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 2-chloro-3-nitropyridine. InChIKey: UUOLETYDNTVQDY-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 2-chloro-3-nitropyridine |
| InChIKey | UUOLETYDNTVQDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)