CAS 22353-33-9 appears in our catalog under these names: 3-Chloro-5-nitropyridine, 98%, 3-Chloro-5-nitropyridine, 3-Chloro-5-nitropyridine, 95%, 95%. Offered by: AmBeed, Chemat, Biosynth, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100mg, 250mg, 5g.
3-chloro-5-nitropyridine (CAS 22353-33-9) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 3-chloro-5-nitropyridine. InChIKey: MUTXEQVAHJCPSL-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 3-chloro-5-nitropyridine |
| InChIKey | MUTXEQVAHJCPSL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)