Products 13091-23-1
CAS 13091-23-1 appears in our catalog under these names: 4-Chloro-3-nitropyridine, 96%, 4-Chloro-3-nitropyridine, 97%, 4-Chloro-3-nitropyridine 95%, 4-CHLORO-3-NITROPYRIDINE, 90%, 4-Chloro-3-nitro-pyridine, 95%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 10g.
4-chloro-3-nitropyridine (CAS 13091-23-1) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 4-chloro-3-nitropyridine. InChIKey: JOTRPRKONYTVBV-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 4-chloro-3-nitropyridine |
| InChIKey | JOTRPRKONYTVBV-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)