cas: 1256806-34-4 — see every product listed under this CAS number, including other names
3-Chloro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one 97% (CAS 1256806-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A216121-100mg |
| cas | 1256806-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 759.75 Pln | |
| Ambeed | 1g | 1794.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A216121 |
3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (CAS 1256806-34-4) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one. InChIKey: DEIJFACUGWLVHU-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 3-chloro-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| InChIKey | DEIJFACUGWLVHU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=N2)Cl)C(=O)N1 |
Computed by PubChem (NCBI)