cas: 58059-29-3 — see every product listed under this CAS number, including other names
3-Chloro-6-(4-chlorophenyl)pyridazine 95% (CAS 58059-29-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A954077-250mg |
| cas | 58059-29-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 642.94 Pln | |
| Ambeed | 10g | 1171.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A954077 |
3-chloro-6-(4-chlorophenyl)pyridazine (CAS 58059-29-3) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 3-chloro-6-(4-chlorophenyl)pyridazine. InChIKey: ARQKIDKGCMDXKY-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 3-chloro-6-(4-chlorophenyl)pyridazine |
| InChIKey | ARQKIDKGCMDXKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)