CAS 100241-11-0 appears in our catalog under these names: 3-Chloro-6-(piperazin-1-yl)pyridazine hydrochloride, ≥97%, ≥97%, 3-Chloro-6-(piperazin-1-yl)pyridazine hydrochloride, ≥97%, 3-Chloro-6-(piperazin-1-yl)pyridazine hydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 100g.
3-chloro-6-piperazin-1-ylpyridazine;hydrochloride (CAS 100241-11-0) is a chemical compound with the molecular formula C8H12Cl2N4 and a molecular weight of 235.11 g/mol. IUPAC name: 3-chloro-6-piperazin-1-ylpyridazine;hydrochloride. InChIKey: NMDKBLUVQLFFOA-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N4 |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 3-chloro-6-piperazin-1-ylpyridazine;hydrochloride |
| InChIKey | NMDKBLUVQLFFOA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NN=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)