3-Chloro-9H-carbazole, 97%
cas: 2732-25-4 — see every product listed under this CAS number, including other names
3-Chloro-9H-carbazole, 97% (CAS 2732-25-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A309139-250mg |
| cas | 2732-25-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 25g | 876.56 Pln | |
| Ambeed | 100g | 2840.12 Pln | |
| Ambeed | 500g | 11139.38 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 342.13 Pln | |
| BLDpharm | 25g | 891.93 Pln | |
| BLDpharm | 100g | 2785.71 Pln | |
| BLDpharm | 500g | 10932.84 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-9H-carbazole (CAS 2732-25-4) is a chemical compound with the molecular formula C12H8ClN and a molecular weight of 201.65 g/mol. IUPAC name: 3-chloro-9H-carbazole. InChIKey: CABSFELLEWZIAK-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 3-chloro-9H-carbazole |
| InChIKey | CABSFELLEWZIAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)