CAS 112929-87-0 is the registry number for 1-(Chloromethyl)-4-cyanonaphthalene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(chloromethyl)naphthalene-1-carbonitrile (CAS 112929-87-0) is a chemical compound with the molecular formula C12H8ClN and a molecular weight of 201.65 g/mol. IUPAC name: 4-(chloromethyl)naphthalene-1-carbonitrile. InChIKey: VZDJWIIALQYVQU-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 4-(chloromethyl)naphthalene-1-carbonitrile |
| InChIKey | VZDJWIIALQYVQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=CC=C(C2=C1)CCl)C#N |
Computed by PubChem (NCBI)