CAS 2732-25-4 appears in our catalog under these names: 3-Chloro-9H-carbazole, >98.0%(GC), 3-Chloro-9H-carbazole 97%, 9H-Carbazole, 3-chloro-, 98%, 98%, 3-Chloro-9H-carbazole, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 500g, 10g, 50g.
3-chloro-9H-carbazole (CAS 2732-25-4) is a chemical compound with the molecular formula C12H8ClN and a molecular weight of 201.65 g/mol. IUPAC name: 3-chloro-9H-carbazole. InChIKey: CABSFELLEWZIAK-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 3-chloro-9H-carbazole |
| InChIKey | CABSFELLEWZIAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)