CAS 5599-70-2 appears in our catalog under these names: 1–Chloro–9H–carbazole, 1-Chloro-9H-carbazole 97%, 1-Chloro-9H-carbazole, 97%, 97%, 1-Chloro-9H-carbazole, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
1-chloro-9H-carbazole (CAS 5599-70-2) is a chemical compound with the molecular formula C12H8ClN and a molecular weight of 201.65 g/mol. IUPAC name: 1-chloro-9H-carbazole. InChIKey: DBDCPKPHHCECLZ-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 1-chloro-9H-carbazole |
| InChIKey | DBDCPKPHHCECLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)Cl |
Computed by PubChem (NCBI)