cas: 7461-38-3 — see every product listed under this CAS number, including other names
3-Chloro-N,N-diethylbenzamide (CAS 7461-38-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FFWF-5mg |
| cas | 7461-38-3 |
| size | 5mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 203.60 Pln | |
| Chemat | 10mg | 251.60 Pln | |
| Chemat | 50mg | 290.00 Pln | |
| Chemat | 250mg | 1149.20 Pln | |
| Chemat | 1g | 3866.00 Pln |
| delivery time | 3 weeks |
|---|
4-chloro-N,N-diethylbenzamide (CAS 7461-38-3) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 4-chloro-N,N-diethylbenzamide. InChIKey: VQIFBGNOSBKNJI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 4-chloro-N,N-diethylbenzamide |
| InChIKey | VQIFBGNOSBKNJI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)