cas: 7461-38-3 — see every product listed under this CAS number, including other names
4-Chloro-N,N-diethylbenzamide, 98% (CAS 7461-38-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F722870-50MG |
| cas | 7461-38-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 471.73 Pln | |
| Fluorochem | 250mg | 1971.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-N,N-diethylbenzamide (CAS 7461-38-3) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 4-chloro-N,N-diethylbenzamide. InChIKey: VQIFBGNOSBKNJI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 4-chloro-N,N-diethylbenzamide |
| InChIKey | VQIFBGNOSBKNJI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)