Products 7461-38-3
CAS 7461-38-3 appears in our catalog under these names: 3-Chloro-N,N-diethylbenzamide, 3-Chloro-N,N-diethylbenzamide, 98%, 4-Chloro-n,n-diethylbenzamide, 95%, 4–Chloro–N，N–diethylbenzamide, NSC 404988. Offered by: Chemat, Combi-blocks, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 5mg, 10mg, 50mg, 250mg, 1g, 5g, 25mg, 100mg.
4-chloro-N,N-diethylbenzamide (CAS 7461-38-3) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 4-chloro-N,N-diethylbenzamide. InChIKey: VQIFBGNOSBKNJI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 4-chloro-N,N-diethylbenzamide |
| InChIKey | VQIFBGNOSBKNJI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)