cas: 17260-71-8 — see every product listed under this CAS number, including other names
3-Chlorobenzenesulfonamide, 95%, 95% (CAS 17260-71-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JAD-1g |
| cas | 17260-71-8 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 587.60 Pln | |
| Chemat | 10g | 942.80 Pln | |
| Chemat | 25g | 1821.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chlorobenzenesulfonamide (CAS 17260-71-8) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 3-chlorobenzenesulfonamide. InChIKey: WSYQJNPRQUFCGL-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 3-chlorobenzenesulfonamide |
| InChIKey | WSYQJNPRQUFCGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)