cas: 856180-58-0 — see every product listed under this CAS number, including other names
3-Chlorobenzofuran-2-carboxylic acid, 97% (CAS 856180-58-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 500mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A104397-5g |
| cas | 856180-58-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17529.82 Pln | |
| AmBeed | 10g | 29176.21 Pln | |
| Fluorochem | 100mg | 1648.40 Pln | |
| Fluorochem | 250mg | 2569.95 Pln | |
| Fluorochem | 1g | 6214.50 Pln | |
| Chemat | 100mg | 981.20 Pln | |
| Chemat | 250mg | 1533.20 Pln | |
| Chemat | 500mg | 2502.80 Pln | |
| Chemat | 1g | 3722.00 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-1-benzofuran-2-carboxylic acid (CAS 856180-58-0) is a chemical compound with the molecular formula C9H5ClO3 and a molecular weight of 196.58 g/mol. IUPAC name: 3-chloro-1-benzofuran-2-carboxylic acid. InChIKey: HYYPKAKRYNNGPH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3 |
|---|---|
| Molecular weight | 196.58 g/mol |
| IUPAC name | 3-chloro-1-benzofuran-2-carboxylic acid |
| InChIKey | HYYPKAKRYNNGPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)