Products 63558-84-9
CAS 63558-84-9 appears in our catalog under these names: 7-Chloro-1-benzofuran-2-carboxylic acid, 95%, 7-Chlorobenzofuran-2-carboxylic acid, 98%, 7-Chlorobenzofuran-2-carboxylic acid, 7-Chlorobenzofuran-2-carboxylic acid, 98%, 98%, 7-Chloro-1-benzofuran-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 0,5g, 100mg.
7-chloro-1-benzofuran-2-carboxylic acid (CAS 63558-84-9) is a chemical compound with the molecular formula C9H5ClO3 and a molecular weight of 196.58 g/mol. IUPAC name: 7-chloro-1-benzofuran-2-carboxylic acid. InChIKey: RWLLNFLRPKWFIF-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3 |
|---|---|
| Molecular weight | 196.58 g/mol |
| IUPAC name | 7-chloro-1-benzofuran-2-carboxylic acid |
| InChIKey | RWLLNFLRPKWFIF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC(=C2)C(=O)O |
Computed by PubChem (NCBI)