CAS 1267393-24-7 is the registry number for 5-Chloroisochromane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-4H-isochromene-1,3-dione (CAS 1267393-24-7) is a chemical compound with the molecular formula C9H5ClO3 and a molecular weight of 196.58 g/mol. IUPAC name: 5-chloro-4H-isochromene-1,3-dione. InChIKey: CQTCPOPRKMEXID-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3 |
|---|---|
| Molecular weight | 196.58 g/mol |
| IUPAC name | 5-chloro-4H-isochromene-1,3-dione |
| InChIKey | CQTCPOPRKMEXID-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Cl)C(=O)OC1=O |
Computed by PubChem (NCBI)