cas: 868944-73-4 — see every product listed under this CAS number, including other names
3-Cyano-4-(5,5-Dimethyl-[1,3,2]dioxaborinan-2-yl)-pyridine (CAS 868944-73-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628111-1G |
| cas | 868944-73-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3455.05 Pln | |
| Fluorochem | 5g | 10233.91 Pln |
| delivery time | 3-4 weeks |
|---|
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine-3-carbonitrile (CAS 868944-73-4) is a chemical compound with the molecular formula C11H13BN2O2 and a molecular weight of 216.05 g/mol. IUPAC name: 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine-3-carbonitrile. InChIKey: JFRIWKOKFKGGCR-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine-3-carbonitrile |
| InChIKey | JFRIWKOKFKGGCR-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=NC=C2)C#N |
Computed by PubChem (NCBI)