Products 1551413-97-8
CAS 1551413-97-8 appears in our catalog under these names: (3-Cyclopropyl-1-methylindazol-5-yl)boronic acid, 96%, (3-Cyclopropyl-1-methylindazol-5-yl)boronic acid 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
(3-cyclopropyl-1-methylindazol-5-yl)boronic acid (CAS 1551413-97-8) is a chemical compound with the molecular formula C11H13BN2O2 and a molecular weight of 216.05 g/mol. IUPAC name: (3-cyclopropyl-1-methylindazol-5-yl)boronic acid. InChIKey: RVDGTXWBYCSPTG-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | (3-cyclopropyl-1-methylindazol-5-yl)boronic acid |
| InChIKey | RVDGTXWBYCSPTG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(N=C2C3CC3)C)(O)O |
Computed by PubChem (NCBI)