Products 876918-90-0
CAS 876918-90-0 is the registry number for 3-Cyano-4-pyrrolidinophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3-cyano-4-pyrrolidin-1-ylphenyl)boronic acid (CAS 876918-90-0) is a chemical compound with the molecular formula C11H13BN2O2 and a molecular weight of 216.05 g/mol. IUPAC name: (3-cyano-4-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: TUWQXPBXVHMPFO-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | (3-cyano-4-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | TUWQXPBXVHMPFO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2CCCC2)C#N)(O)O |
Computed by PubChem (NCBI)