Products 868944-73-4
CAS 868944-73-4 is the registry number for 3-Cyano-4-(5,5-Dimethyl-[1,3,2]dioxaborinan-2-yl)-pyridine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine-3-carbonitrile (CAS 868944-73-4) is a chemical compound with the molecular formula C11H13BN2O2 and a molecular weight of 216.05 g/mol. IUPAC name: 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine-3-carbonitrile. InChIKey: JFRIWKOKFKGGCR-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine-3-carbonitrile |
| InChIKey | JFRIWKOKFKGGCR-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=NC=C2)C#N |
Computed by PubChem (NCBI)