CAS 98556-65-1 appears in our catalog under these names: 3-Cyano-5-nitrobenzoic acid, 97%, 97%, 3-Cyano-5-nitrobenzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg.
3-cyano-5-nitrobenzoic acid (CAS 98556-65-1) is a chemical compound with the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. IUPAC name: 3-cyano-5-nitrobenzoic acid. InChIKey: GHUIBKBNBPSUTC-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O4 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 3-cyano-5-nitrobenzoic acid |
| InChIKey | GHUIBKBNBPSUTC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)