CAS 603-62-3 appears in our catalog under these names: 3–Nitrophthalimide, 3-Nitrophthalimide, 3-Nitrophthalimide/ 98%, 3-Nitrophthalimide, 98% , 3-Nitrophthalimide 98%. Offered by: GLPBio, HPC Standards, Chemat, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 500g, 1x1000mg, 25g, 5g, 100g, 1000g, 10G, 1g.
4-nitroisoindole-1,3-dione (CAS 603-62-3) is a chemical compound with the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. IUPAC name: 4-nitroisoindole-1,3-dione. InChIKey: BONIIQYTWOPUQI-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O4 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 4-nitroisoindole-1,3-dione |
| InChIKey | BONIIQYTWOPUQI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NC2=O |
Computed by PubChem (NCBI)