Products 1260834-31-8
CAS 1260834-31-8 appears in our catalog under these names: 2–Cyano–3–nitrobenzoic acid, 2-Cyano-3-nitrobenzoic acid 97%, 2-Cyano-3-nitrobenzoic acid, 97%, 97%, 2-Cyano-3-nitrobenzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg.
2-cyano-3-nitrobenzoic acid (CAS 1260834-31-8) is a chemical compound with the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. IUPAC name: 2-cyano-3-nitrobenzoic acid. InChIKey: DFPVVWZPOOLICC-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O4 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 2-cyano-3-nitrobenzoic acid |
| InChIKey | DFPVVWZPOOLICC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C#N)C(=O)O |
Computed by PubChem (NCBI)